C11H13ClFNO2 — CID 104980074
ethyl (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate (PubChem CID 104980074) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 104980074 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | ethyl (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H13ClFNO2/c1-2-16-11(15)6-10(14)8-4-3-7(12)5-9(8)13/h3-5,10H,2,6,14H2,1H3/t10-/m0/s1 |
| InChIKey | OGDRHNSAJJVVHU-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |