C12H14Cl2F3NO2 — CID 171227139
ethyl (3S)-3-amino-3-[4-chloro-2-(trifluoromethyl)phenyl]propanoate;hydrochloride (PubChem CID 171227139) has the molecular formula C12H14Cl2F3NO2 and a molecular weight of 332.15 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[4-chloro-2-(trifluoromethyl)phenyl]propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-[4-chloro-2-(trifluoromethyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171227139 |
| Molecular Formula | C12H14Cl2F3NO2 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | ethyl (3S)-3-amino-3-[4-chloro-2-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(Cl)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C12H13ClF3NO2.ClH/c1-2-19-11(18)6-10(17)8-4-3-7(13)5-9(8)12(14,15)16;/h3-5,10H,2,6,17H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | WSTWQXQAPQMPSR-PPHPATTJSA-N |
| XLogP | 3.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |