C9H10ClFN2O — CID 104980078
(3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanamide (PubChem CID 104980078) has the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. Its IUPAC name is (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanamide.
| Compound Name | (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 104980078 |
| Molecular Formula | C9H10ClFN2O |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (3S)-3-amino-3-(4-chloro-2-fluorophenyl)propanamide |
| SMILES | NC(=O)C[C@H](N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN2O/c10-5-1-2-6(7(11)3-5)8(12)4-9(13)14/h1-3,8H,4,12H2,(H2,13,14)/t8-/m0/s1 |
| InChIKey | KIZBEHIKNJMLGG-QMMMGPOBSA-N |
| XLogP | 1.35 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |