C10H11ClFN3O2 — CID 54928613
2-amino-N-(4-chloro-2-fluorophenyl)butanediamide (PubChem CID 54928613) has the molecular formula C10H11ClFN3O2 and a molecular weight of 259.67 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-2-fluorophenyl)butanediamide.
| Compound Name | 2-amino-N-(4-chloro-2-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 54928613 |
| Molecular Formula | C10H11ClFN3O2 |
| Molecular Weight | 259.67 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-amino-N-(4-chloro-2-fluorophenyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C10H11ClFN3O2/c11-5-1-2-8(6(12)3-5)15-10(17)7(13)4-9(14)16/h1-3,7H,4,13H2,(H2,14,16)(H,15,17) |
| InChIKey | GIUCLVWIRFVICO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.67 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |