C11H14FNO2 — CID 723062
ethyl (3S)-3-amino-3-(2-fluorophenyl)propanoate (PubChem CID 723062) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-fluorophenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 723062 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-fluorophenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccccc1F |
| InChI | InChI=1S/C11H14FNO2/c1-2-15-11(14)7-10(13)8-5-3-4-6-9(8)12/h3-6,10H,2,7,13H2,1H3/t10-/m0/s1 |
| InChIKey | IBFWPUOXJBELLB-JTQLQIEISA-N |
| XLogP | 1.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |