C12H16FNO3 — CID 171225305
ethyl (3S)-3-amino-3-(2-fluoro-3-methoxyphenyl)propanoate (PubChem CID 171225305) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-fluoro-3-methoxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-fluoro-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 171225305 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-fluoro-3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1cccc(OC)c1F |
| InChI | InChI=1S/C12H16FNO3/c1-3-17-11(15)7-9(14)8-5-4-6-10(16-2)12(8)13/h4-6,9H,3,7,14H2,1-2H3/t9-/m0/s1 |
| InChIKey | JVPICQTWZUHIEZ-VIFPVBQESA-N |
| XLogP | 1.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |