C12H14F3NO2S — CID 171231427
ethyl (3S)-3-amino-3-[2-(trifluoromethylsulfanyl)phenyl]propanoate (PubChem CID 171231427) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[2-(trifluoromethylsulfanyl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-amino-3-[2-(trifluoromethylsulfanyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171231427 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | ethyl (3S)-3-amino-3-[2-(trifluoromethylsulfanyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2S/c1-2-18-11(17)7-9(16)8-5-3-4-6-10(8)19-12(13,14)15/h3-6,9H,2,7,16H2,1H3/t9-/m0/s1 |
| InChIKey | UYLYYIZOUWKTNR-VIFPVBQESA-N |
| XLogP | 3.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |