C16H19FN2O4 — CID 175859507
2-[(2-butoxy-2-oxoethyl)-[(4-cyano-2-fluorophenyl)methyl]amino]acetic acid (PubChem CID 175859507) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-[(2-butoxy-2-oxoethyl)-[(4-cyano-2-fluorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[(2-butoxy-2-oxoethyl)-[(4-cyano-2-fluorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 175859507 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[(2-butoxy-2-oxoethyl)-[(4-cyano-2-fluorophenyl)methyl]amino]acetic acid |
| SMILES | CCCCOC(=O)CN(CC(=O)O)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C16H19FN2O4/c1-2-3-6-23-16(22)11-19(10-15(20)21)9-13-5-4-12(8-18)7-14(13)17/h4-5,7H,2-3,6,9-11H2,1H3,(H,20,21) |
| InChIKey | MHHGHJGESFCWGV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|