C11H11FN2O2 — CID 43442256
2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetic acid (PubChem CID 43442256) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 43442256 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1cc(C#N)ccc1F |
| InChI | InChI=1S/C11H11FN2O2/c1-14(7-11(15)16)6-9-4-8(5-13)2-3-10(9)12/h2-4H,6-7H2,1H3,(H,15,16) |
| InChIKey | LOKONGSZRIDWNS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |