C12H13FN2O4S — CID 60951292
3-[(5-cyano-2-fluorophenyl)methyl-methylsulfamoyl]propanoic acid (PubChem CID 60951292) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[(5-cyano-2-fluorophenyl)methyl-methylsulfamoyl]propanoic acid.
| Compound Name | 3-[(5-cyano-2-fluorophenyl)methyl-methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60951292 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-[(5-cyano-2-fluorophenyl)methyl-methylsulfamoyl]propanoic acid |
| SMILES | CN(Cc1cc(C#N)ccc1F)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C12H13FN2O4S/c1-15(20(18,19)5-4-12(16)17)8-10-6-9(7-14)2-3-11(10)13/h2-3,6H,4-5,8H2,1H3,(H,16,17) |
| InChIKey | NCFCAEHZIRNIJM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |