(5-cyano-2-fluorophenyl)methanesulfonyl fluoride

C8H5F2NO2S — CID 165453498

IUPAC(5-cyano-2-fluorophenyl)methanesulfonyl fluoride
SMILESN#Cc1ccc(F)c(CS(=O)(=O)F)c1
InChIInChI=1S/C8H5F2NO2S/c9-8-2-1-6(4-11)3-7(8)5-14(10,12)13/h1-3H,5H2
InChIKeyLZTRHXADBLARRC-UHFFFAOYSA-N
MW217.20 g/mol
LogP1.50
Rot. Bonds2

About (5-cyano-2-fluorophenyl)methanesulfonyl fluoride

(5-cyano-2-fluorophenyl)methanesulfonyl fluoride (PubChem CID 165453498) has the molecular formula C8H5F2NO2S and a molecular weight of 217.20 g/mol. Its IUPAC name is (5-cyano-2-fluorophenyl)methanesulfonyl fluoride.

Molecular Properties

Compound Name(5-cyano-2-fluorophenyl)methanesulfonyl fluoride
PubChem CID165453498
Molecular FormulaC8H5F2NO2S
Molecular Weight217.20 g/mol
Exact Mass217.00
IUPAC Name(5-cyano-2-fluorophenyl)methanesulfonyl fluoride
SMILESN#Cc1ccc(F)c(CS(=O)(=O)F)c1
InChIInChI=1S/C8H5F2NO2S/c9-8-2-1-6(4-11)3-7(8)5-14(10,12)13/h1-3H,5H2
InChIKeyLZTRHXADBLARRC-UHFFFAOYSA-N
XLogP1.50
TPSA57.93 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.20
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (5-cyano-2-fluorophenyl)methanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-cyano-2-fluorophenyl)methanesulfonyl fluoride?
The IUPAC name of (5-cyano-2-fluorophenyl)methanesulfonyl fluoride (CID 165453498) is (5-cyano-2-fluorophenyl)methanesulfonyl fluoride.
What is the SMILES notation for (5-cyano-2-fluorophenyl)methanesulfonyl fluoride?
The canonical SMILES for (5-cyano-2-fluorophenyl)methanesulfonyl fluoride is N#Cc1ccc(F)c(CS(=O)(=O)F)c1.
What is the InChIKey of (5-cyano-2-fluorophenyl)methanesulfonyl fluoride?
The InChIKey is LZTRHXADBLARRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO2S/c9-8-2-1-6(4-11)3-7(8)5-14(10,12)13/h1-3H,5H2.
What are the key properties of (5-cyano-2-fluorophenyl)methanesulfonyl fluoride?
(5-cyano-2-fluorophenyl)methanesulfonyl fluoride has a molecular weight of 217.20 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-2-fluorophenyl)methanesulfonyl fluoride is sourced from PubChem (CID 165453498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).