C14H14FNO4S — CID 65443313
2-[1-[(5-cyano-2-fluorophenyl)methylsulfonylmethyl]cyclopropyl]acetic acid (PubChem CID 65443313) has the molecular formula C14H14FNO4S and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[1-[(5-cyano-2-fluorophenyl)methylsulfonylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(5-cyano-2-fluorophenyl)methylsulfonylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443313 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[1-[(5-cyano-2-fluorophenyl)methylsulfonylmethyl]cyclopropyl]acetic acid |
| SMILES | N#Cc1ccc(F)c(CS(=O)(=O)CC2(CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C14H14FNO4S/c15-12-2-1-10(7-16)5-11(12)8-21(19,20)9-14(3-4-14)6-13(17)18/h1-2,5H,3-4,6,8-9H2,(H,17,18) |
| InChIKey | BLJRATJSXUAQKO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |