C9H7F3N2 — CID 170438138
3-(2-amino-2,2-difluoroethyl)-4-fluorobenzonitrile (PubChem CID 170438138) has the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. Its IUPAC name is 3-(2-amino-2,2-difluoroethyl)-4-fluorobenzonitrile.
| Compound Name | 3-(2-amino-2,2-difluoroethyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 170438138 |
| Molecular Formula | C9H7F3N2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(2-amino-2,2-difluoroethyl)-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CC(N)(F)F)c1 |
| InChI | InChI=1S/C9H7F3N2/c10-8-2-1-6(5-13)3-7(8)4-9(11,12)14/h1-3H,4,14H2 |
| InChIKey | NCACKNJPJPLRSA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|