C17H17FN2 — CID 61036267
3-fluoro-4-[(N,3,5-trimethylanilino)methyl]benzonitrile (PubChem CID 61036267) has the molecular formula C17H17FN2 and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-fluoro-4-[(N,3,5-trimethylanilino)methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(N,3,5-trimethylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 61036267 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-fluoro-4-[(N,3,5-trimethylanilino)methyl]benzonitrile |
| SMILES | Cc1cc(C)cc(N(C)Cc2ccc(C#N)cc2F)c1 |
| InChI | InChI=1S/C17H17FN2/c1-12-6-13(2)8-16(7-12)20(3)11-15-5-4-14(10-19)9-17(15)18/h4-9H,11H2,1-3H3 |
| InChIKey | SBAWECDORSUFBL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |