C16H14F2N2 — CID 81283403
3,5-difluoro-4-(N,3,5-trimethylanilino)benzonitrile (PubChem CID 81283403) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3,5-difluoro-4-(N,3,5-trimethylanilino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(N,3,5-trimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 81283403 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3,5-difluoro-4-(N,3,5-trimethylanilino)benzonitrile |
| SMILES | Cc1cc(C)cc(N(C)c2c(F)cc(C#N)cc2F)c1 |
| InChI | InChI=1S/C16H14F2N2/c1-10-4-11(2)6-13(5-10)20(3)16-14(17)7-12(9-19)8-15(16)18/h4-8H,1-3H3 |
| InChIKey | ICRHPWLJIUEROF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |