C10H11F2N3 — CID 81294307
4-[2-aminoethyl(methyl)amino]-3,5-difluorobenzonitrile (PubChem CID 81294307) has the molecular formula C10H11F2N3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-[2-aminoethyl(methyl)amino]-3,5-difluorobenzonitrile.
| Compound Name | 4-[2-aminoethyl(methyl)amino]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81294307 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-[2-aminoethyl(methyl)amino]-3,5-difluorobenzonitrile |
| SMILES | CN(CCN)c1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C10H11F2N3/c1-15(3-2-13)10-8(11)4-7(6-14)5-9(10)12/h4-5H,2-3,13H2,1H3 |
| InChIKey | NRXXUCHCTLLOLO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |