C9H13F2N3 — CID 82506193
1-N-(2-aminoethyl)-2,6-difluoro-1-N-methylbenzene-1,4-diamine (PubChem CID 82506193) has the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-2,6-difluoro-1-N-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(2-aminoethyl)-2,6-difluoro-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 82506193 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 1-N-(2-aminoethyl)-2,6-difluoro-1-N-methylbenzene-1,4-diamine |
| SMILES | CN(CCN)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C9H13F2N3/c1-14(3-2-12)9-7(10)4-6(13)5-8(9)11/h4-5H,2-3,12-13H2,1H3 |
| InChIKey | DLBMBWQEBCIRGV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|