C11H16F2N2O2 — CID 54993188
1-(4-amino-2,6-difluoro-N-methylanilino)-3-methoxypropan-2-ol (PubChem CID 54993188) has the molecular formula C11H16F2N2O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(4-amino-2,6-difluoro-N-methylanilino)-3-methoxypropan-2-ol.
| Compound Name | 1-(4-amino-2,6-difluoro-N-methylanilino)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 54993188 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(4-amino-2,6-difluoro-N-methylanilino)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H16F2N2O2/c1-15(5-8(16)6-17-2)11-9(12)3-7(14)4-10(11)13/h3-4,8,16H,5-6,14H2,1-2H3 |
| InChIKey | ZWQSWBYDQNGTFP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|