C13H20FNO3 — CID 63372729
1-[4-fluoro-2-[(1R)-1-hydroxyethyl]-N-methylanilino]-3-methoxypropan-2-ol (PubChem CID 63372729) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-[4-fluoro-2-[(1R)-1-hydroxyethyl]-N-methylanilino]-3-methoxypropan-2-ol.
| Compound Name | 1-[4-fluoro-2-[(1R)-1-hydroxyethyl]-N-methylanilino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 63372729 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-[4-fluoro-2-[(1R)-1-hydroxyethyl]-N-methylanilino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1ccc(F)cc1[C@@H](C)O |
| InChI | InChI=1S/C13H20FNO3/c1-9(16)12-6-10(14)4-5-13(12)15(2)7-11(17)8-18-3/h4-6,9,11,16-17H,7-8H2,1-3H3/t9-,11?/m1/s1 |
| InChIKey | QKRSQJHZQJQDCF-BFHBGLAWSA-N |
| XLogP | 1.32 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |