C14H22FNO3 — CID 78940044
(1R)-1-[2-[bis(2-methoxyethyl)amino]-5-fluorophenyl]ethanol (PubChem CID 78940044) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is (1R)-1-[2-[bis(2-methoxyethyl)amino]-5-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-[bis(2-methoxyethyl)amino]-5-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 78940044 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R)-1-[2-[bis(2-methoxyethyl)amino]-5-fluorophenyl]ethanol |
| SMILES | COCCN(CCOC)c1ccc(F)cc1[C@@H](C)O |
| InChI | InChI=1S/C14H22FNO3/c1-11(17)13-10-12(15)4-5-14(13)16(6-8-18-2)7-9-19-3/h4-5,10-11,17H,6-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | OSGNSYTYNVCLAH-LLVKDONJSA-N |
| XLogP | 1.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |