C16H27FN2O2 — CID 61418293
2-[1-(ethylamino)ethyl]-4-fluoro-N,N-bis(2-methoxyethyl)aniline (PubChem CID 61418293) has the molecular formula C16H27FN2O2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-[1-(ethylamino)ethyl]-4-fluoro-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 2-[1-(ethylamino)ethyl]-4-fluoro-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 61418293 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[1-(ethylamino)ethyl]-4-fluoro-N,N-bis(2-methoxyethyl)aniline |
| SMILES | CCNC(C)c1cc(F)ccc1N(CCOC)CCOC |
| InChI | InChI=1S/C16H27FN2O2/c1-5-18-13(2)15-12-14(17)6-7-16(15)19(8-10-20-3)9-11-21-4/h6-7,12-13,18H,5,8-11H2,1-4H3 |
| InChIKey | OSKBRTMOUPXFBI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |