C15H25FN2S — CID 112660621
2-[1-(ethylamino)ethyl]-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline (PubChem CID 112660621) has the molecular formula C15H25FN2S and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[1-(ethylamino)ethyl]-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline.
| Compound Name | 2-[1-(ethylamino)ethyl]-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 112660621 |
| Molecular Formula | C15H25FN2S |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[1-(ethylamino)ethyl]-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline |
| SMILES | CCNC(C)c1cc(F)ccc1N(C)C(C)CSC |
| InChI | InChI=1S/C15H25FN2S/c1-6-17-12(3)14-9-13(16)7-8-15(14)18(4)11(2)10-19-5/h7-9,11-12,17H,6,10H2,1-5H3 |
| InChIKey | OPUYUYNJKFFZGA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |