C13H21FN2S — CID 112666798
2-(2-aminoethyl)-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline (PubChem CID 112666798) has the molecular formula C13H21FN2S and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline.
| Compound Name | 2-(2-aminoethyl)-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 112666798 |
| Molecular Formula | C13H21FN2S |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(2-aminoethyl)-4-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)aniline |
| SMILES | CSCC(C)N(C)c1ccc(F)cc1CCN |
| InChI | InChI=1S/C13H21FN2S/c1-10(9-17-3)16(2)13-5-4-12(14)8-11(13)6-7-15/h4-5,8,10H,6-7,9,15H2,1-3H3 |
| InChIKey | SFNLPRMTQVCBRM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |