C17H29FN2 — CID 79489813
2-(2-aminoethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline (PubChem CID 79489813) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline.
| Compound Name | 2-(2-aminoethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 79489813 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-(2-aminoethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
| SMILES | CCC(CC)N(CC(C)C)c1ccc(F)cc1CCN |
| InChI | InChI=1S/C17H29FN2/c1-5-16(6-2)20(12-13(3)4)17-8-7-15(18)11-14(17)9-10-19/h7-8,11,13,16H,5-6,9-10,12,19H2,1-4H3 |
| InChIKey | XIHMGAOOHVUDEX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |