C16H26F2N2 — CID 79483856
2-(difluoromethyl)-1-N-(2-methylpropyl)-1-N-pentan-3-ylbenzene-1,4-diamine (PubChem CID 79483856) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(2-methylpropyl)-1-N-pentan-3-ylbenzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(2-methylpropyl)-1-N-pentan-3-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 79483856 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(2-methylpropyl)-1-N-pentan-3-ylbenzene-1,4-diamine |
| SMILES | CCC(CC)N(CC(C)C)c1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C16H26F2N2/c1-5-13(6-2)20(10-11(3)4)15-8-7-12(19)9-14(15)16(17)18/h7-9,11,13,16H,5-6,10,19H2,1-4H3 |
| InChIKey | SKOCJUFCFQPLAK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|