C17H29BrN2 — CID 82968396
2-(1-aminoethyl)-5-bromo-N-(2-methylpropyl)-N-pentan-3-ylaniline (PubChem CID 82968396) has the molecular formula C17H29BrN2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-bromo-N-(2-methylpropyl)-N-pentan-3-ylaniline.
| Compound Name | 2-(1-aminoethyl)-5-bromo-N-(2-methylpropyl)-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 82968396 |
| Molecular Formula | C17H29BrN2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-(1-aminoethyl)-5-bromo-N-(2-methylpropyl)-N-pentan-3-ylaniline |
| SMILES | CCC(CC)N(CC(C)C)c1cc(Br)ccc1C(C)N |
| InChI | InChI=1S/C17H29BrN2/c1-6-15(7-2)20(11-12(3)4)17-10-14(18)8-9-16(17)13(5)19/h8-10,12-13,15H,6-7,11,19H2,1-5H3 |
| InChIKey | MQPNTBWWGKQOQM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |