C16H25BrFN — CID 107084455
2-(bromomethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline (PubChem CID 107084455) has the molecular formula C16H25BrFN and a molecular weight of 330.29 g/mol. Its IUPAC name is 2-(bromomethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline.
| Compound Name | 2-(bromomethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
|---|---|
| PubChem CID | 107084455 |
| Molecular Formula | C16H25BrFN |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(bromomethyl)-4-fluoro-N-(2-methylpropyl)-N-pentan-3-ylaniline |
| SMILES | CCC(CC)N(CC(C)C)c1ccc(F)cc1CBr |
| InChI | InChI=1S/C16H25BrFN/c1-5-15(6-2)19(11-12(3)4)16-8-7-14(18)9-13(16)10-17/h7-9,12,15H,5-6,10-11H2,1-4H3 |
| InChIKey | IMANHGNBYPZHIL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|