C14H21BrFN — CID 107082126
2-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylaniline (PubChem CID 107082126) has the molecular formula C14H21BrFN and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylaniline.
| Compound Name | 2-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 107082126 |
| Molecular Formula | C14H21BrFN |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylaniline |
| SMILES | CC(N(C)c1ccc(F)cc1CBr)C(C)(C)C |
| InChI | InChI=1S/C14H21BrFN/c1-10(14(2,3)4)17(5)13-7-6-12(16)8-11(13)9-15/h6-8,10H,9H2,1-5H3 |
| InChIKey | URGJJAWTLXGMMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|