C14H21ClFNO2S — CID 102920066
2-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-5-fluoro-N-methylbenzenesulfonamide (PubChem CID 102920066) has the molecular formula C14H21ClFNO2S and a molecular weight of 321.85 g/mol. Its IUPAC name is 2-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-5-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 2-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-5-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102920066 |
| Molecular Formula | C14H21ClFNO2S |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-5-fluoro-N-methylbenzenesulfonamide |
| SMILES | CC(N(C)S(=O)(=O)c1cc(F)ccc1CCl)C(C)(C)C |
| InChI | InChI=1S/C14H21ClFNO2S/c1-10(14(2,3)4)17(5)20(18,19)13-8-12(16)7-6-11(13)9-15/h6-8,10H,9H2,1-5H3 |
| InChIKey | NYCFKJNRHJFNLT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|