C15H23BrClNO2S — CID 81480810
3-bromo-5-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-N,2-dimethylbenzenesulfonamide (PubChem CID 81480810) has the molecular formula C15H23BrClNO2S and a molecular weight of 396.78 g/mol. Its IUPAC name is 3-bromo-5-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-N,2-dimethylbenzenesulfonamide.
| Compound Name | 3-bromo-5-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 81480810 |
| Molecular Formula | C15H23BrClNO2S |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 3-bromo-5-(chloromethyl)-N-(3,3-dimethylbutan-2-yl)-N,2-dimethylbenzenesulfonamide |
| SMILES | Cc1c(Br)cc(CCl)cc1S(=O)(=O)N(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C15H23BrClNO2S/c1-10-13(16)7-12(9-17)8-14(10)21(19,20)18(6)11(2)15(3,4)5/h7-8,11H,9H2,1-6H3 |
| InChIKey | FOCWHUXEELKRKP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|