C14H21BrClNO2S — CID 81487750
3-bromo-5-(chloromethyl)-N,2-dimethyl-N-pentan-2-ylbenzenesulfonamide (PubChem CID 81487750) has the molecular formula C14H21BrClNO2S and a molecular weight of 382.75 g/mol. Its IUPAC name is 3-bromo-5-(chloromethyl)-N,2-dimethyl-N-pentan-2-ylbenzenesulfonamide.
| Compound Name | 3-bromo-5-(chloromethyl)-N,2-dimethyl-N-pentan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 81487750 |
| Molecular Formula | C14H21BrClNO2S |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 3-bromo-5-(chloromethyl)-N,2-dimethyl-N-pentan-2-ylbenzenesulfonamide |
| SMILES | CCCC(C)N(C)S(=O)(=O)c1cc(CCl)cc(Br)c1C |
| InChI | InChI=1S/C14H21BrClNO2S/c1-5-6-10(2)17(4)20(18,19)14-8-12(9-16)7-13(15)11(14)3/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | MRBDPXTWSALMKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|