C14H22BrNO2S — CID 65479619
4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylbenzenesulfonamide (PubChem CID 65479619) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 65479619 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-(bromomethyl)-N-(3,3-dimethylbutan-2-yl)-N-methylbenzenesulfonamide |
| SMILES | CC(N(C)S(=O)(=O)c1ccc(CBr)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H22BrNO2S/c1-11(14(2,3)4)16(5)19(17,18)13-8-6-12(10-15)7-9-13/h6-9,11H,10H2,1-5H3 |
| InChIKey | LPQTUIBYBUQXPC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|