C16H18Br2ClNO4S2 — CID 161423385
4-(bromomethyl)benzenesulfonyl chloride;4-(bromomethyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 161423385) has the molecular formula C16H18Br2ClNO4S2 and a molecular weight of 547.72 g/mol. Its IUPAC name is 4-(bromomethyl)benzenesulfonyl chloride;4-(bromomethyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(bromomethyl)benzenesulfonyl chloride;4-(bromomethyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 161423385 |
| Molecular Formula | C16H18Br2ClNO4S2 |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 544.87 |
| IUPAC Name | 4-(bromomethyl)benzenesulfonyl chloride;4-(bromomethyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CBr)cc1.O=S(=O)(Cl)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C9H12BrNO2S.C7H6BrClO2S/c1-11(2)14(12,13)9-5-3-8(7-10)4-6-9;8-5-6-1-3-7(4-2-6)12(9,10)11/h3-6H,7H2,1-2H3;1-4H,5H2 |
| InChIKey | VXAMJEYIZKONSN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|