C11H16ClNO2S — CID 63205177
4-(2-chloropropyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 63205177) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is 4-(2-chloropropyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(2-chloropropyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63205177 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-(2-chloropropyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(Cl)Cc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C11H16ClNO2S/c1-9(12)8-10-4-6-11(7-5-10)16(14,15)13(2)3/h4-7,9H,8H2,1-3H3 |
| InChIKey | URRMGJHWMMYOSJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|