C11H15ClN2O4S — CID 63205710
4-(2-chloropropyl)-N,N-dimethyl-3-nitrobenzenesulfonamide (PubChem CID 63205710) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is 4-(2-chloropropyl)-N,N-dimethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(2-chloropropyl)-N,N-dimethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63205710 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-(2-chloropropyl)-N,N-dimethyl-3-nitrobenzenesulfonamide |
| SMILES | CC(Cl)Cc1ccc(S(=O)(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15ClN2O4S/c1-8(12)6-9-4-5-10(7-11(9)14(15)16)19(17,18)13(2)3/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | YZOFEFOMFTWACT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|