C9H11ClN2O4S — CID 8777803
3-chloro-N,N,4-trimethyl-5-nitrobenzenesulfonamide (PubChem CID 8777803) has the molecular formula C9H11ClN2O4S and a molecular weight of 278.72 g/mol. Its IUPAC name is 3-chloro-N,N,4-trimethyl-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N,N,4-trimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8777803 |
| Molecular Formula | C9H11ClN2O4S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 3-chloro-N,N,4-trimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN2O4S/c1-6-8(10)4-7(5-9(6)12(13)14)17(15,16)11(2)3/h4-5H,1-3H3 |
| InChIKey | KLXIXMNZYGSCBS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|