C16H17ClN2O4S — CID 8796570
3-chloro-N,4-dimethyl-N-[(2-methylphenyl)methyl]-5-nitrobenzenesulfonamide (PubChem CID 8796570) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-N-[(2-methylphenyl)methyl]-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N,4-dimethyl-N-[(2-methylphenyl)methyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8796570 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 3-chloro-N,4-dimethyl-N-[(2-methylphenyl)methyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccccc1CN(C)S(=O)(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17ClN2O4S/c1-11-6-4-5-7-13(11)10-18(3)24(22,23)14-8-15(17)12(2)16(9-14)19(20)21/h4-9H,10H2,1-3H3 |
| InChIKey | FNGWLKRPKZOCTR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|