C13H13ClN2O4S2 — CID 9190935
3-chloro-N,4-dimethyl-5-nitro-N-(thiophen-3-ylmethyl)benzenesulfonamide (PubChem CID 9190935) has the molecular formula C13H13ClN2O4S2 and a molecular weight of 360.84 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-5-nitro-N-(thiophen-3-ylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N,4-dimethyl-5-nitro-N-(thiophen-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9190935 |
| Molecular Formula | C13H13ClN2O4S2 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3-chloro-N,4-dimethyl-5-nitro-N-(thiophen-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N(C)Cc2ccsc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClN2O4S2/c1-9-12(14)5-11(6-13(9)16(17)18)22(19,20)15(2)7-10-3-4-21-8-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | INDQAZSBNNILMD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|