C16H18ClN3O6S2 — CID 46820889
3-chloro-N,4-dimethyl-5-nitro-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 46820889) has the molecular formula C16H18ClN3O6S2 and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-5-nitro-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N,4-dimethyl-5-nitro-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46820889 |
| Molecular Formula | C16H18ClN3O6S2 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 3-chloro-N,4-dimethyl-5-nitro-N-[1-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N(C)C(C)c2ccc(S(N)(=O)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18ClN3O6S2/c1-10-15(17)8-14(9-16(10)20(21)22)28(25,26)19(3)11(2)12-4-6-13(7-5-12)27(18,23)24/h4-9,11H,1-3H3,(H2,18,23,24) |
| InChIKey | GNTBTQXDDOHANN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|