C17H19ClN2O6S2 — CID 55556491
3-chloro-N,4-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-nitrobenzenesulfonamide (PubChem CID 55556491) has the molecular formula C17H19ClN2O6S2 and a molecular weight of 446.93 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N,4-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55556491 |
| Molecular Formula | C17H19ClN2O6S2 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 3-chloro-N,4-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N(C)C(C)c2ccc(S(C)(=O)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19ClN2O6S2/c1-11-16(18)9-15(10-17(11)20(21)22)28(25,26)19(3)12(2)13-5-7-14(8-6-13)27(4,23)24/h5-10,12H,1-4H3 |
| InChIKey | QCAJKYLGNAZOJN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|