C14H16ClNO4S3 — CID 55556486
5-chloro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 55556486) has the molecular formula C14H16ClNO4S3 and a molecular weight of 393.94 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55556486 |
| Molecular Formula | C14H16ClNO4S3 |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 5-chloro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClNO4S3/c1-10(11-4-6-12(7-5-11)22(3,17)18)16(2)23(19,20)14-9-8-13(15)21-14/h4-10H,1-3H3 |
| InChIKey | ZOSRIPMJNRNHIN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |