C14H14ClNO3S2 — CID 26957732
5-chloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 26957732) has the molecular formula C14H14ClNO3S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26957732 |
| Molecular Formula | C14H14ClNO3S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 5-chloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Cl)s1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H14ClNO3S2/c1-9(16-14(17)12-7-8-13(15)20-12)10-3-5-11(6-4-10)21(2,18)19/h3-9H,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | DICLXLSRKDWURA-SECBINFHSA-N |
| XLogP | 3.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |