C17H20ClNO3S — CID 9418965
5-chloro-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 9418965) has the molecular formula C17H20ClNO3S and a molecular weight of 353.87 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9418965 |
| Molecular Formula | C17H20ClNO3S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-chloro-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2ccc(Cl)s2)cc1OCC |
| InChI | InChI=1S/C17H20ClNO3S/c1-4-21-13-7-6-12(10-14(13)22-5-2)11(3)19-17(20)15-8-9-16(18)23-15/h6-11H,4-5H2,1-3H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | RUPGIUVHJFXJOA-NSHDSACASA-N |
| XLogP | 4.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |