C20H22F3NO3 — CID 2573137
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 2573137) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2573137 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)c2ccccc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C20H22F3NO3/c1-4-26-17-11-10-14(12-18(17)27-5-2)13(3)24-19(25)15-8-6-7-9-16(15)20(21,22)23/h6-13H,4-5H2,1-3H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | ZNEMFEJNLWEMKN-CYBMUJFWSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |