C22H26F3NO4 — CID 47071495
N-[1-(3,4-diethoxyphenyl)ethyl]-2-phenyl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 47071495) has the molecular formula C22H26F3NO4 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-2-phenyl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2-phenyl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 47071495 |
| Molecular Formula | C22H26F3NO4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2-phenyl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCOc1ccc(C(C)NC(=O)C(OCC(F)(F)F)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H26F3NO4/c1-4-28-18-12-11-17(13-19(18)29-5-2)15(3)26-21(27)20(30-14-22(23,24)25)16-9-7-6-8-10-16/h6-13,15,20H,4-5,14H2,1-3H3,(H,26,27) |
| InChIKey | SWBQVBUWASXKHG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |