C22H24N2O4 — CID 2579582
N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 2579582) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2579582 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2cc(=O)[nH]c3ccccc23)cc1OCC |
| InChI | InChI=1S/C22H24N2O4/c1-4-27-19-11-10-15(12-20(19)28-5-2)14(3)23-22(26)17-13-21(25)24-18-9-7-6-8-16(17)18/h6-14H,4-5H2,1-3H3,(H,23,26)(H,24,25)/t14-/m0/s1 |
| InChIKey | JERJBJRZXWDMFX-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |