C21H24N2O3 — CID 9162190
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 9162190) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 9162190 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)c2cc3ccccc3[nH]2)cc1OCC |
| InChI | InChI=1S/C21H24N2O3/c1-4-25-19-11-10-15(13-20(19)26-5-2)14(3)22-21(24)18-12-16-8-6-7-9-17(16)23-18/h6-14,23H,4-5H2,1-3H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | HOPZBYCJHGJNJE-CQSZACIVSA-N |
| XLogP | 4.46 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |