C15H16ClNO3S — CID 26212642
5-chloro-N-(3,4-diethoxyphenyl)thiophene-2-carboxamide (PubChem CID 26212642) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 5-chloro-N-(3,4-diethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3,4-diethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26212642 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 5-chloro-N-(3,4-diethoxyphenyl)thiophene-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(Cl)s2)cc1OCC |
| InChI | InChI=1S/C15H16ClNO3S/c1-3-19-11-6-5-10(9-12(11)20-4-2)17-15(18)13-7-8-14(16)21-13/h5-9H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | BCPUPWXIJNRWHN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |