C21H26N2O4S — CID 24590454
5-(cyclopropanecarbonylamino)-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide (PubChem CID 24590454) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-(cyclopropanecarbonylamino)-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(cyclopropanecarbonylamino)-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24590454 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 5-(cyclopropanecarbonylamino)-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2ccc(NC(=O)C3CC3)s2)cc1OCCC |
| InChI | InChI=1S/C21H26N2O4S/c1-3-11-26-16-8-7-15(13-17(16)27-12-4-2)22-21(25)18-9-10-19(28-18)23-20(24)14-5-6-14/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | NFFFYAAFAGUZCO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |