C19H30N2O5S — CID 55544635
N-(3,4-dipropoxyphenyl)-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 55544635) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-(3,4-dipropoxyphenyl)-1-methylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-(3,4-dipropoxyphenyl)-1-methylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55544635 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-(3,4-dipropoxyphenyl)-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CCCCN2S(C)(=O)=O)cc1OCCC |
| InChI | InChI=1S/C19H30N2O5S/c1-4-12-25-17-10-9-15(14-18(17)26-13-5-2)20-19(22)16-8-6-7-11-21(16)27(3,23)24/h9-10,14,16H,4-8,11-13H2,1-3H3,(H,20,22) |
| InChIKey | AAMOIHFQXBZWNU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |